About N-ethyl-3-phenyl-1,2,4-triazin-5-amine;piperidine
N-ethyl-3-phenyl-1,2,4-triazin-5-amine;piperidine (PubChem CID 19787769) has the molecular formula C16H23N5
and a molecular weight of 285.39 g/mol. Its IUPAC name is N-ethyl-3-phenyl-1,2,4-triazin-5-amine;piperidine.
Molecular Properties
| Compound Name | N-ethyl-3-phenyl-1,2,4-triazin-5-amine;piperidine |
| PubChem CID | 19787769 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | N-ethyl-3-phenyl-1,2,4-triazin-5-amine;piperidine |
| SMILES | C1CCNCC1.CCNc1cnnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C11H12N4.C5H11N/c1-2-12-10-8-13-15-11(14-10)9-6-4-3-5-7-9;1-2-4-6-5-3-1/h3-8H,2H2,1H3,(H,12,14,15);6H,1-5H2 |
| InChIKey | MEQQWDJQLYLSFE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-ethyl-3-phenyl-1,2,4-triazin-5-amine;piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-3-phenyl-1,2,4-triazin-5-amine;piperidine?
The IUPAC name of N-ethyl-3-phenyl-1,2,4-triazin-5-amine;piperidine (CID 19787769) is N-ethyl-3-phenyl-1,2,4-triazin-5-amine;piperidine.
What is the SMILES notation for N-ethyl-3-phenyl-1,2,4-triazin-5-amine;piperidine?
The canonical SMILES for N-ethyl-3-phenyl-1,2,4-triazin-5-amine;piperidine is C1CCNCC1.CCNc1cnnc(-c2ccccc2)n1.
What is the InChIKey of N-ethyl-3-phenyl-1,2,4-triazin-5-amine;piperidine?
The InChIKey is MEQQWDJQLYLSFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4.C5H11N/c1-2-12-10-8-13-15-11(14-10)9-6-4-3-5-7-9;1-2-4-6-5-3-1/h3-8H,2H2,1H3,(H,12,14,15);6H,1-5H2.
What are the key properties of N-ethyl-3-phenyl-1,2,4-triazin-5-amine;piperidine?
N-ethyl-3-phenyl-1,2,4-triazin-5-amine;piperidine has a molecular weight of 285.39 g/mol, XLogP of 2.73, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-3-phenyl-1,2,4-triazin-5-amine;piperidine is sourced from PubChem (CID 19787769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).