C24H28ClN5 — CID 19787795
5-benzyl-3-(4-chlorophenyl)-N-(3-piperidin-1-ylpropyl)-1,2,4-triazin-6-amine (PubChem CID 19787795) has the molecular formula C24H28ClN5 and a molecular weight of 421.98 g/mol. Its IUPAC name is 5-benzyl-3-(4-chlorophenyl)-N-(3-piperidin-1-ylpropyl)-1,2,4-triazin-6-amine.
| Compound Name | 5-benzyl-3-(4-chlorophenyl)-N-(3-piperidin-1-ylpropyl)-1,2,4-triazin-6-amine |
|---|---|
| PubChem CID | 19787795 |
| Molecular Formula | C24H28ClN5 |
| Molecular Weight | 421.98 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 5-benzyl-3-(4-chlorophenyl)-N-(3-piperidin-1-ylpropyl)-1,2,4-triazin-6-amine |
| SMILES | Clc1ccc(-c2nnc(NCCCN3CCCCC3)c(Cc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H28ClN5/c25-21-12-10-20(11-13-21)23-27-22(18-19-8-3-1-4-9-19)24(29-28-23)26-14-7-17-30-15-5-2-6-16-30/h1,3-4,8-13H,2,5-7,14-18H2,(H,26,29) |
| InChIKey | XGGHTXOAORLRNE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.98 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|