About 1-(2,2-dimethylpyrano[3,2-c]pyridin-4-yl)pyridin-2-one;propanedioic acid
1-(2,2-dimethylpyrano[3,2-c]pyridin-4-yl)pyridin-2-one;propanedioic acid (PubChem CID 19787857) has the molecular formula C18H18N2O6
and a molecular weight of 358.35 g/mol. Its IUPAC name is 1-(2,2-dimethylpyrano[3,2-c]pyridin-4-yl)pyridin-2-one;propanedioic acid.
Molecular Properties
| Compound Name | 1-(2,2-dimethylpyrano[3,2-c]pyridin-4-yl)pyridin-2-one;propanedioic acid |
| PubChem CID | 19787857 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 1-(2,2-dimethylpyrano[3,2-c]pyridin-4-yl)pyridin-2-one;propanedioic acid |
| SMILES | CC1(C)C=C(n2ccccc2=O)c2cnccc2O1.O=C(O)CC(=O)O |
| InChI | InChI=1S/C15H14N2O2.C3H4O4/c1-15(2)9-12(17-8-4-3-5-14(17)18)11-10-16-7-6-13(11)19-15;4-2(5)1-3(6)7/h3-10H,1-2H3;1H2,(H,4,5)(H,6,7) |
| InChIKey | OYNOSVDMGUFQEW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-dimethylpyrano[3,2-c]pyridin-4-yl)pyridin-2-one;propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethylpyrano[3,2-c]pyridin-4-yl)pyridin-2-one;propanedioic acid?
The IUPAC name of 1-(2,2-dimethylpyrano[3,2-c]pyridin-4-yl)pyridin-2-one;propanedioic acid (CID 19787857) is 1-(2,2-dimethylpyrano[3,2-c]pyridin-4-yl)pyridin-2-one;propanedioic acid.
What is the SMILES notation for 1-(2,2-dimethylpyrano[3,2-c]pyridin-4-yl)pyridin-2-one;propanedioic acid?
The canonical SMILES for 1-(2,2-dimethylpyrano[3,2-c]pyridin-4-yl)pyridin-2-one;propanedioic acid is CC1(C)C=C(n2ccccc2=O)c2cnccc2O1.O=C(O)CC(=O)O.
What is the InChIKey of 1-(2,2-dimethylpyrano[3,2-c]pyridin-4-yl)pyridin-2-one;propanedioic acid?
The InChIKey is OYNOSVDMGUFQEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2.C3H4O4/c1-15(2)9-12(17-8-4-3-5-14(17)18)11-10-16-7-6-13(11)19-15;4-2(5)1-3(6)7/h3-10H,1-2H3;1H2,(H,4,5)(H,6,7).
What are the key properties of 1-(2,2-dimethylpyrano[3,2-c]pyridin-4-yl)pyridin-2-one;propanedioic acid?
1-(2,2-dimethylpyrano[3,2-c]pyridin-4-yl)pyridin-2-one;propanedioic acid has a molecular weight of 358.35 g/mol, XLogP of 1.85, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethylpyrano[3,2-c]pyridin-4-yl)pyridin-2-one;propanedioic acid is sourced from PubChem (CID 19787857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).