About piperidin-4-ylcarbamic acid
piperidin-4-ylcarbamic acid (PubChem CID 19787930) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is piperidin-4-ylcarbamic acid.
Molecular Properties
| Compound Name | piperidin-4-ylcarbamic acid |
| PubChem CID | 19787930 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | piperidin-4-ylcarbamic acid |
| SMILES | O=C(O)NC1CCNCC1 |
| InChI | InChI=1S/C6H12N2O2/c9-6(10)8-5-1-3-7-4-2-5/h5,7-8H,1-4H2,(H,9,10) |
| InChIKey | KBOGICFUPOMDKS-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze piperidin-4-ylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-ylcarbamic acid?
The IUPAC name of piperidin-4-ylcarbamic acid (CID 19787930) is piperidin-4-ylcarbamic acid.
What is the SMILES notation for piperidin-4-ylcarbamic acid?
The canonical SMILES for piperidin-4-ylcarbamic acid is O=C(O)NC1CCNCC1.
What is the InChIKey of piperidin-4-ylcarbamic acid?
The InChIKey is KBOGICFUPOMDKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2/c9-6(10)8-5-1-3-7-4-2-5/h5,7-8H,1-4H2,(H,9,10).
What are the key properties of piperidin-4-ylcarbamic acid?
piperidin-4-ylcarbamic acid has a molecular weight of 144.17 g/mol, XLogP of 0.01, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-ylcarbamic acid is sourced from PubChem (CID 19787930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).