About piperidin-4-ylmethyl carbamate
piperidin-4-ylmethyl carbamate (PubChem CID 19787931) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is piperidin-4-ylmethyl carbamate.
Molecular Properties
| Compound Name | piperidin-4-ylmethyl carbamate |
| PubChem CID | 19787931 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | piperidin-4-ylmethyl carbamate |
| SMILES | NC(=O)OCC1CCNCC1 |
| InChI | InChI=1S/C7H14N2O2/c8-7(10)11-5-6-1-3-9-4-2-6/h6,9H,1-5H2,(H2,8,10) |
| InChIKey | JMIDSOKOEHWPQW-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidin-4-ylmethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-ylmethyl carbamate?
The IUPAC name of piperidin-4-ylmethyl carbamate (CID 19787931) is piperidin-4-ylmethyl carbamate.
What is the SMILES notation for piperidin-4-ylmethyl carbamate?
The canonical SMILES for piperidin-4-ylmethyl carbamate is NC(=O)OCC1CCNCC1.
What is the InChIKey of piperidin-4-ylmethyl carbamate?
The InChIKey is JMIDSOKOEHWPQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2/c8-7(10)11-5-6-1-3-9-4-2-6/h6,9H,1-5H2,(H2,8,10).
What are the key properties of piperidin-4-ylmethyl carbamate?
piperidin-4-ylmethyl carbamate has a molecular weight of 158.20 g/mol, XLogP of 0.08, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-ylmethyl carbamate is sourced from PubChem (CID 19787931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).