C14H19N — CID 19787957
5-azatricyclo[9.4.0.02,7]pentadeca-8,12,14-triene (PubChem CID 19787957) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 5-azatricyclo[9.4.0.02,7]pentadeca-8,12,14-triene.
| Compound Name | 5-azatricyclo[9.4.0.02,7]pentadeca-8,12,14-triene |
|---|---|
| PubChem CID | 19787957 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 5-azatricyclo[9.4.0.02,7]pentadeca-8,12,14-triene |
| SMILES | C1=CC2CC=CC3CNCCC3C2C=C1 |
| InChI | InChI=1S/C14H19N/c1-2-7-13-11(4-1)5-3-6-12-10-15-9-8-14(12)13/h1-4,6-7,11-15H,5,8-10H2 |
| InChIKey | YZUQQASFSVNTQK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|