C13H11F5OS — CID 19788112
2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethylsulfanyl)chromene (PubChem CID 19788112) has the molecular formula C13H11F5OS and a molecular weight of 310.29 g/mol. Its IUPAC name is 2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethylsulfanyl)chromene.
| Compound Name | 2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethylsulfanyl)chromene |
|---|---|
| PubChem CID | 19788112 |
| Molecular Formula | C13H11F5OS |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethylsulfanyl)chromene |
| SMILES | CC1(C)C=Cc2cc(SC(F)(F)C(F)(F)F)ccc2O1 |
| InChI | InChI=1S/C13H11F5OS/c1-11(2)6-5-8-7-9(3-4-10(8)19-11)20-13(17,18)12(14,15)16/h3-7H,1-2H3 |
| InChIKey | OPOLTSDEIMYXSN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|