About 3-(diaminomethylidene)-1,1-dipropylguanidine
3-(diaminomethylidene)-1,1-dipropylguanidine (PubChem CID 19788243) has the molecular formula C8H19N5
and a molecular weight of 185.28 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1,1-dipropylguanidine.
Molecular Properties
| Compound Name | 3-(diaminomethylidene)-1,1-dipropylguanidine |
| PubChem CID | 19788243 |
| Molecular Formula | C8H19N5 |
| Molecular Weight | 185.28 g/mol |
| Exact Mass | 185.16 |
| IUPAC Name | 3-(diaminomethylidene)-1,1-dipropylguanidine |
| SMILES | [H]/N=C(\N=C(N)N)N(CCC)CCC |
| InChI | InChI=1S/C8H19N5/c1-3-5-13(6-4-2)8(11)12-7(9)10/h3-6H2,1-2H3,(H5,9,10,11,12) |
| InChIKey | SQTHMGUHVUGMOU-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(diaminomethylidene)-1,1-dipropylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diaminomethylidene)-1,1-dipropylguanidine?
The IUPAC name of 3-(diaminomethylidene)-1,1-dipropylguanidine (CID 19788243) is 3-(diaminomethylidene)-1,1-dipropylguanidine.
What is the SMILES notation for 3-(diaminomethylidene)-1,1-dipropylguanidine?
The canonical SMILES for 3-(diaminomethylidene)-1,1-dipropylguanidine is [H]/N=C(\N=C(N)N)N(CCC)CCC.
What is the InChIKey of 3-(diaminomethylidene)-1,1-dipropylguanidine?
The InChIKey is SQTHMGUHVUGMOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N5/c1-3-5-13(6-4-2)8(11)12-7(9)10/h3-6H2,1-2H3,(H5,9,10,11,12).
What are the key properties of 3-(diaminomethylidene)-1,1-dipropylguanidine?
3-(diaminomethylidene)-1,1-dipropylguanidine has a molecular weight of 185.28 g/mol, XLogP of 0.32, 4 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diaminomethylidene)-1,1-dipropylguanidine is sourced from PubChem (CID 19788243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).