C18H21NO5 — CID 19788701
ethyl 2-amino-4-[2-(4-ethoxycarbonylphenyl)ethyl]furan-3-carboxylate (PubChem CID 19788701) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is ethyl 2-amino-4-[2-(4-ethoxycarbonylphenyl)ethyl]furan-3-carboxylate.
| Compound Name | ethyl 2-amino-4-[2-(4-ethoxycarbonylphenyl)ethyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 19788701 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | ethyl 2-amino-4-[2-(4-ethoxycarbonylphenyl)ethyl]furan-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(CCc2coc(N)c2C(=O)OCC)cc1 |
| InChI | InChI=1S/C18H21NO5/c1-3-22-17(20)13-8-5-12(6-9-13)7-10-14-11-24-16(19)15(14)18(21)23-4-2/h5-6,8-9,11H,3-4,7,10,19H2,1-2H3 |
| InChIKey | HETWGEYDWDPASR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |