C10H14Cl6N4O2 — CID 19788814
1-N,4-N-bis(2,2,2-trichloroethyl)piperazine-1,4-dicarboxamide (PubChem CID 19788814) has the molecular formula C10H14Cl6N4O2 and a molecular weight of 434.97 g/mol. Its IUPAC name is 1-N,4-N-bis(2,2,2-trichloroethyl)piperazine-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis(2,2,2-trichloroethyl)piperazine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 19788814 |
| Molecular Formula | C10H14Cl6N4O2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 431.92 |
| IUPAC Name | 1-N,4-N-bis(2,2,2-trichloroethyl)piperazine-1,4-dicarboxamide |
| SMILES | O=C(NCC(Cl)(Cl)Cl)N1CCN(C(=O)NCC(Cl)(Cl)Cl)CC1 |
| InChI | InChI=1S/C10H14Cl6N4O2/c11-9(12,13)5-17-7(21)19-1-2-20(4-3-19)8(22)18-6-10(14,15)16/h1-6H2,(H,17,21)(H,18,22) |
| InChIKey | PEMUPXNRKUQNOM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|