About (2-methoxy-2-oxoethyl) 2-hydroxypropanoate;3-methyl-1,4-dioxane-2,5-dione
(2-methoxy-2-oxoethyl) 2-hydroxypropanoate;3-methyl-1,4-dioxane-2,5-dione (PubChem CID 19788815) has the molecular formula C11H16O9
and a molecular weight of 292.24 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 2-hydroxypropanoate;3-methyl-1,4-dioxane-2,5-dione.
Molecular Properties
| Compound Name | (2-methoxy-2-oxoethyl) 2-hydroxypropanoate;3-methyl-1,4-dioxane-2,5-dione |
| PubChem CID | 19788815 |
| Molecular Formula | C11H16O9 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 2-hydroxypropanoate;3-methyl-1,4-dioxane-2,5-dione |
| SMILES | CC1OC(=O)COC1=O.COC(=O)COC(=O)C(C)O |
| InChI | InChI=1S/C6H10O5.C5H6O4/c1-4(7)6(9)11-3-5(8)10-2;1-3-5(7)8-2-4(6)9-3/h4,7H,3H2,1-2H3;3H,2H2,1H3 |
| InChIKey | KANLCZFUBIQRRG-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze (2-methoxy-2-oxoethyl) 2-hydroxypropanoate;3-methyl-1,4-dioxane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxy-2-oxoethyl) 2-hydroxypropanoate;3-methyl-1,4-dioxane-2,5-dione?
The IUPAC name of (2-methoxy-2-oxoethyl) 2-hydroxypropanoate;3-methyl-1,4-dioxane-2,5-dione (CID 19788815) is (2-methoxy-2-oxoethyl) 2-hydroxypropanoate;3-methyl-1,4-dioxane-2,5-dione.
What is the SMILES notation for (2-methoxy-2-oxoethyl) 2-hydroxypropanoate;3-methyl-1,4-dioxane-2,5-dione?
The canonical SMILES for (2-methoxy-2-oxoethyl) 2-hydroxypropanoate;3-methyl-1,4-dioxane-2,5-dione is CC1OC(=O)COC1=O.COC(=O)COC(=O)C(C)O.
What is the InChIKey of (2-methoxy-2-oxoethyl) 2-hydroxypropanoate;3-methyl-1,4-dioxane-2,5-dione?
The InChIKey is KANLCZFUBIQRRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O5.C5H6O4/c1-4(7)6(9)11-3-5(8)10-2;1-3-5(7)8-2-4(6)9-3/h4,7H,3H2,1-2H3;3H,2H2,1H3.
What are the key properties of (2-methoxy-2-oxoethyl) 2-hydroxypropanoate;3-methyl-1,4-dioxane-2,5-dione?
(2-methoxy-2-oxoethyl) 2-hydroxypropanoate;3-methyl-1,4-dioxane-2,5-dione has a molecular weight of 292.24 g/mol, XLogP of -1.44, 3 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-2-oxoethyl) 2-hydroxypropanoate;3-methyl-1,4-dioxane-2,5-dione is sourced from PubChem (CID 19788815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).