About 6-methylhept-6-en-3-one
6-methylhept-6-en-3-one (PubChem CID 19789134) has the molecular formula C8H14O
and a molecular weight of 126.20 g/mol. Its IUPAC name is 6-methylhept-6-en-3-one.
Molecular Properties
| Compound Name | 6-methylhept-6-en-3-one |
| PubChem CID | 19789134 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | 6-methylhept-6-en-3-one |
| SMILES | C=C(C)CCC(=O)CC |
| InChI | InChI=1S/C8H14O/c1-4-8(9)6-5-7(2)3/h2,4-6H2,1,3H3 |
| InChIKey | WELSHTLLGUXPLG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methylhept-6-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylhept-6-en-3-one?
The IUPAC name of 6-methylhept-6-en-3-one (CID 19789134) is 6-methylhept-6-en-3-one.
What is the SMILES notation for 6-methylhept-6-en-3-one?
The canonical SMILES for 6-methylhept-6-en-3-one is C=C(C)CCC(=O)CC.
What is the InChIKey of 6-methylhept-6-en-3-one?
The InChIKey is WELSHTLLGUXPLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O/c1-4-8(9)6-5-7(2)3/h2,4-6H2,1,3H3.
What are the key properties of 6-methylhept-6-en-3-one?
6-methylhept-6-en-3-one has a molecular weight of 126.20 g/mol, XLogP of 2.32, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylhept-6-en-3-one is sourced from PubChem (CID 19789134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).