C19H21NO2S2 — CID 19789672
2-[tert-butyl(sulfino)amino]-3-(4-methylphenyl)-1-benzothiophene (PubChem CID 19789672) has the molecular formula C19H21NO2S2 and a molecular weight of 359.52 g/mol. Its IUPAC name is 2-[tert-butyl(sulfino)amino]-3-(4-methylphenyl)-1-benzothiophene.
| Compound Name | 2-[tert-butyl(sulfino)amino]-3-(4-methylphenyl)-1-benzothiophene |
|---|---|
| PubChem CID | 19789672 |
| Molecular Formula | C19H21NO2S2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 2-[tert-butyl(sulfino)amino]-3-(4-methylphenyl)-1-benzothiophene |
| SMILES | Cc1ccc(-c2c(N(S(=O)O)C(C)(C)C)sc3ccccc23)cc1 |
| InChI | InChI=1S/C19H21NO2S2/c1-13-9-11-14(12-10-13)17-15-7-5-6-8-16(15)23-18(17)20(24(21)22)19(2,3)4/h5-12H,1-4H3,(H,21,22) |
| InChIKey | KKAOAVHJOPVDPY-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|