C6H5F5N2 — CID 19789824
5-methyl-4-(1,1,2,2,2-pentafluoroethyl)-1H-imidazole (PubChem CID 19789824) has the molecular formula C6H5F5N2 and a molecular weight of 200.11 g/mol. Its IUPAC name is 5-methyl-4-(1,1,2,2,2-pentafluoroethyl)-1H-imidazole.
| Compound Name | 5-methyl-4-(1,1,2,2,2-pentafluoroethyl)-1H-imidazole |
|---|---|
| PubChem CID | 19789824 |
| Molecular Formula | C6H5F5N2 |
| Molecular Weight | 200.11 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 5-methyl-4-(1,1,2,2,2-pentafluoroethyl)-1H-imidazole |
| SMILES | Cc1[nH]cnc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H5F5N2/c1-3-4(13-2-12-3)5(7,8)6(9,10)11/h2H,1H3,(H,12,13) |
| InChIKey | LNNOBYFYYODLRK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.11 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|