About N,N-diethylacetamide;N,N-dimethylacetamide
N,N-diethylacetamide;N,N-dimethylacetamide (PubChem CID 19790046) has the molecular formula C10H22N2O2
and a molecular weight of 202.30 g/mol. Its IUPAC name is N,N-diethylacetamide;N,N-dimethylacetamide.
Molecular Properties
| Compound Name | N,N-diethylacetamide;N,N-dimethylacetamide |
| PubChem CID | 19790046 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | N,N-diethylacetamide;N,N-dimethylacetamide |
| SMILES | CC(=O)N(C)C.CCN(CC)C(C)=O |
| InChI | InChI=1S/C6H13NO.C4H9NO/c1-4-7(5-2)6(3)8;1-4(6)5(2)3/h4-5H2,1-3H3;1-3H3 |
| InChIKey | UDOAGKGFYFYQNZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethylacetamide;N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylacetamide;N,N-dimethylacetamide?
The IUPAC name of N,N-diethylacetamide;N,N-dimethylacetamide (CID 19790046) is N,N-diethylacetamide;N,N-dimethylacetamide.
What is the SMILES notation for N,N-diethylacetamide;N,N-dimethylacetamide?
The canonical SMILES for N,N-diethylacetamide;N,N-dimethylacetamide is CC(=O)N(C)C.CCN(CC)C(C)=O.
What is the InChIKey of N,N-diethylacetamide;N,N-dimethylacetamide?
The InChIKey is UDOAGKGFYFYQNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.C4H9NO/c1-4-7(5-2)6(3)8;1-4(6)5(2)3/h4-5H2,1-3H3;1-3H3.
What are the key properties of N,N-diethylacetamide;N,N-dimethylacetamide?
N,N-diethylacetamide;N,N-dimethylacetamide has a molecular weight of 202.30 g/mol, XLogP of 0.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylacetamide;N,N-dimethylacetamide is sourced from PubChem (CID 19790046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).