About 2-[3,5,7-tris(2-aminoethyl)cyclooctyl]ethanamine
2-[3,5,7-tris(2-aminoethyl)cyclooctyl]ethanamine (PubChem CID 19790328) has the molecular formula C16H36N4
and a molecular weight of 284.49 g/mol. Its IUPAC name is 2-[3,5,7-tris(2-aminoethyl)cyclooctyl]ethanamine.
Molecular Properties
| Compound Name | 2-[3,5,7-tris(2-aminoethyl)cyclooctyl]ethanamine |
| PubChem CID | 19790328 |
| Molecular Formula | C16H36N4 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.29 |
| IUPAC Name | 2-[3,5,7-tris(2-aminoethyl)cyclooctyl]ethanamine |
| SMILES | NCCC1CC(CCN)CC(CCN)CC(CCN)C1 |
| InChI | InChI=1S/C16H36N4/c17-5-1-13-9-14(2-6-18)11-16(4-8-20)12-15(10-13)3-7-19/h13-16H,1-12,17-20H2 |
| InChIKey | QVUOWCBNHOMVAD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3,5,7-tris(2-aminoethyl)cyclooctyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5,7-tris(2-aminoethyl)cyclooctyl]ethanamine?
The IUPAC name of 2-[3,5,7-tris(2-aminoethyl)cyclooctyl]ethanamine (CID 19790328) is 2-[3,5,7-tris(2-aminoethyl)cyclooctyl]ethanamine.
What is the SMILES notation for 2-[3,5,7-tris(2-aminoethyl)cyclooctyl]ethanamine?
The canonical SMILES for 2-[3,5,7-tris(2-aminoethyl)cyclooctyl]ethanamine is NCCC1CC(CCN)CC(CCN)CC(CCN)C1.
What is the InChIKey of 2-[3,5,7-tris(2-aminoethyl)cyclooctyl]ethanamine?
The InChIKey is QVUOWCBNHOMVAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N4/c17-5-1-13-9-14(2-6-18)11-16(4-8-20)12-15(10-13)3-7-19/h13-16H,1-12,17-20H2.
What are the key properties of 2-[3,5,7-tris(2-aminoethyl)cyclooctyl]ethanamine?
2-[3,5,7-tris(2-aminoethyl)cyclooctyl]ethanamine has a molecular weight of 284.49 g/mol, XLogP of 1.42, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5,7-tris(2-aminoethyl)cyclooctyl]ethanamine is sourced from PubChem (CID 19790328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).