C26H30N2O4 — CID 19791515
oxalic acid;16-(4-phenylbutyl)-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene (PubChem CID 19791515) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is oxalic acid;16-(4-phenylbutyl)-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene.
| Compound Name | oxalic acid;16-(4-phenylbutyl)-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene |
|---|---|
| PubChem CID | 19791515 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | oxalic acid;16-(4-phenylbutyl)-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3,5,7-tetraene |
| SMILES | O=C(O)C(=O)O.c1ccc(CCCCN2C3CCCC2c2c([nH]c4ccccc24)C3)cc1 |
| InChI | InChI=1S/C24H28N2.C2H2O4/c1-2-9-18(10-3-1)11-6-7-16-26-19-12-8-15-23(26)24-20-13-4-5-14-21(20)25-22(24)17-19;3-1(4)2(5)6/h1-5,9-10,13-14,19,23,25H,6-8,11-12,15-17H2;(H,3,4)(H,5,6) |
| InChIKey | UCEDPPQWLJVKCX-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|