C28H45N3O3 — CID 19791628
2-(cyclohexylmethyl)-3-[4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]-N-[4-(methylamino)-4-oxobutyl]propanamide (PubChem CID 19791628) has the molecular formula C28H45N3O3 and a molecular weight of 471.69 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-3-[4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]-N-[4-(methylamino)-4-oxobutyl]propanamide.
| Compound Name | 2-(cyclohexylmethyl)-3-[4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]-N-[4-(methylamino)-4-oxobutyl]propanamide |
|---|---|
| PubChem CID | 19791628 |
| Molecular Formula | C28H45N3O3 |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.35 |
| IUPAC Name | 2-(cyclohexylmethyl)-3-[4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]-N-[4-(methylamino)-4-oxobutyl]propanamide |
| SMILES | CNC(=O)CCCNC(=O)C(CC1CCCCC1)CN1CCC(C)(c2cccc(O)c2)C(C)C1 |
| InChI | InChI=1S/C28H45N3O3/c1-21-19-31(16-14-28(21,2)24-11-7-12-25(32)18-24)20-23(17-22-9-5-4-6-10-22)27(34)30-15-8-13-26(33)29-3/h7,11-12,18,21-23,32H,4-6,8-10,13-17,19-20H2,1-3H3,(H,29,33)(H,30,34) |
| InChIKey | LBNNFGNPGYDXTQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|