C27H43N3O3 — CID 19791647
N-(4-amino-4-oxobutyl)-2-(cyclohexylmethyl)-3-[4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]propanamide (PubChem CID 19791647) has the molecular formula C27H43N3O3 and a molecular weight of 457.66 g/mol. Its IUPAC name is N-(4-amino-4-oxobutyl)-2-(cyclohexylmethyl)-3-[4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]propanamide.
| Compound Name | N-(4-amino-4-oxobutyl)-2-(cyclohexylmethyl)-3-[4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 19791647 |
| Molecular Formula | C27H43N3O3 |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.33 |
| IUPAC Name | N-(4-amino-4-oxobutyl)-2-(cyclohexylmethyl)-3-[4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]propanamide |
| SMILES | CC1CN(CC(CC2CCCCC2)C(=O)NCCCC(N)=O)CCC1(C)c1cccc(O)c1 |
| InChI | InChI=1S/C27H43N3O3/c1-20-18-30(15-13-27(20,2)23-10-6-11-24(31)17-23)19-22(16-21-8-4-3-5-9-21)26(33)29-14-7-12-25(28)32/h6,10-11,17,20-22,31H,3-5,7-9,12-16,18-19H2,1-2H3,(H2,28,32)(H,29,33) |
| InChIKey | QFWXVLMJWMHGDO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|