C46H48N8 — CID 19792025
2-N-butyl-4-N,4-N-diethyl-6-methyl-2-N-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrimidine-2,4-diamine (PubChem CID 19792025) has the molecular formula C46H48N8 and a molecular weight of 712.95 g/mol. Its IUPAC name is 2-N-butyl-4-N,4-N-diethyl-6-methyl-2-N-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-butyl-4-N,4-N-diethyl-6-methyl-2-N-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 19792025 |
| Molecular Formula | C46H48N8 |
| Molecular Weight | 712.95 g/mol |
| Exact Mass | 712.40 |
| IUPAC Name | 2-N-butyl-4-N,4-N-diethyl-6-methyl-2-N-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]pyrimidine-2,4-diamine |
| SMILES | CCCCN(Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1)c1nc(C)cc(N(CC)CC)n1 |
| InChI | InChI=1S/C46H48N8/c1-5-8-32-53(45-47-35(4)33-43(48-45)52(6-2)7-3)34-36-28-30-37(31-29-36)41-26-18-19-27-42(41)44-49-50-51-54(44)46(38-20-12-9-13-21-38,39-22-14-10-15-23-39)40-24-16-11-17-25-40/h9-31,33H,5-8,32,34H2,1-4H3 |
| InChIKey | GUEHESXWJCEFBD-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 75.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.95 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|