About (2,2-diethoxy-2-methoxyethyl) 2-methylprop-2-enoate
(2,2-diethoxy-2-methoxyethyl) 2-methylprop-2-enoate (PubChem CID 19792354) has the molecular formula C11H20O5
and a molecular weight of 232.28 g/mol. Its IUPAC name is (2,2-diethoxy-2-methoxyethyl) 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | (2,2-diethoxy-2-methoxyethyl) 2-methylprop-2-enoate |
| PubChem CID | 19792354 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (2,2-diethoxy-2-methoxyethyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(OC)(OCC)OCC |
| InChI | InChI=1S/C11H20O5/c1-6-15-11(13-5,16-7-2)8-14-10(12)9(3)4/h3,6-8H2,1-2,4-5H3 |
| InChIKey | URYWXMHZLSZSNE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2,2-diethoxy-2-methoxyethyl) 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-diethoxy-2-methoxyethyl) 2-methylprop-2-enoate?
The IUPAC name of (2,2-diethoxy-2-methoxyethyl) 2-methylprop-2-enoate (CID 19792354) is (2,2-diethoxy-2-methoxyethyl) 2-methylprop-2-enoate.
What is the SMILES notation for (2,2-diethoxy-2-methoxyethyl) 2-methylprop-2-enoate?
The canonical SMILES for (2,2-diethoxy-2-methoxyethyl) 2-methylprop-2-enoate is C=C(C)C(=O)OCC(OC)(OCC)OCC.
What is the InChIKey of (2,2-diethoxy-2-methoxyethyl) 2-methylprop-2-enoate?
The InChIKey is URYWXMHZLSZSNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O5/c1-6-15-11(13-5,16-7-2)8-14-10(12)9(3)4/h3,6-8H2,1-2,4-5H3.
What are the key properties of (2,2-diethoxy-2-methoxyethyl) 2-methylprop-2-enoate?
(2,2-diethoxy-2-methoxyethyl) 2-methylprop-2-enoate has a molecular weight of 232.28 g/mol, XLogP of 1.48, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-diethoxy-2-methoxyethyl) 2-methylprop-2-enoate is sourced from PubChem (CID 19792354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).