About 4-ethylmorpholin-4-ium;1-propan-2-ylpyrrolidin-1-ium
4-ethylmorpholin-4-ium;1-propan-2-ylpyrrolidin-1-ium (PubChem CID 19792725) has the molecular formula C13H30N2O+2
and a molecular weight of 230.40 g/mol. Its IUPAC name is 4-ethylmorpholin-4-ium;1-propan-2-ylpyrrolidin-1-ium.
Molecular Properties
| Compound Name | 4-ethylmorpholin-4-ium;1-propan-2-ylpyrrolidin-1-ium |
| PubChem CID | 19792725 |
| Molecular Formula | C13H30N2O+2 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.23 |
| IUPAC Name | 4-ethylmorpholin-4-ium;1-propan-2-ylpyrrolidin-1-ium |
| SMILES | CC(C)[NH+]1CCCC1.CC[NH+]1CCOCC1 |
| InChI | InChI=1S/C7H15N.C6H13NO/c1-7(2)8-5-3-4-6-8;1-2-7-3-5-8-6-4-7/h7H,3-6H2,1-2H3;2-6H2,1H3/p+2 |
| InChIKey | VYTIHLDTFKFHET-UHFFFAOYSA-P |
| XLogP | -1.01 |
| TPSA | 18.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethylmorpholin-4-ium;1-propan-2-ylpyrrolidin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylmorpholin-4-ium;1-propan-2-ylpyrrolidin-1-ium?
The IUPAC name of 4-ethylmorpholin-4-ium;1-propan-2-ylpyrrolidin-1-ium (CID 19792725) is 4-ethylmorpholin-4-ium;1-propan-2-ylpyrrolidin-1-ium.
What is the SMILES notation for 4-ethylmorpholin-4-ium;1-propan-2-ylpyrrolidin-1-ium?
The canonical SMILES for 4-ethylmorpholin-4-ium;1-propan-2-ylpyrrolidin-1-ium is CC(C)[NH+]1CCCC1.CC[NH+]1CCOCC1.
What is the InChIKey of 4-ethylmorpholin-4-ium;1-propan-2-ylpyrrolidin-1-ium?
The InChIKey is VYTIHLDTFKFHET-UHFFFAOYSA-P. The full InChI is InChI=1S/C7H15N.C6H13NO/c1-7(2)8-5-3-4-6-8;1-2-7-3-5-8-6-4-7/h7H,3-6H2,1-2H3;2-6H2,1H3/p+2.
What are the key properties of 4-ethylmorpholin-4-ium;1-propan-2-ylpyrrolidin-1-ium?
4-ethylmorpholin-4-ium;1-propan-2-ylpyrrolidin-1-ium has a molecular weight of 230.40 g/mol, XLogP of -1.01, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylmorpholin-4-ium;1-propan-2-ylpyrrolidin-1-ium is sourced from PubChem (CID 19792725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).