C33H40F2O3 — CID 19793042
heptyl 3-(2-fluoro-4-heptylphenyl)-4-(2-fluorophenyl)benzenecarboperoxoate (PubChem CID 19793042) has the molecular formula C33H40F2O3 and a molecular weight of 522.68 g/mol. Its IUPAC name is heptyl 3-(2-fluoro-4-heptylphenyl)-4-(2-fluorophenyl)benzenecarboperoxoate.
| Compound Name | heptyl 3-(2-fluoro-4-heptylphenyl)-4-(2-fluorophenyl)benzenecarboperoxoate |
|---|---|
| PubChem CID | 19793042 |
| Molecular Formula | C33H40F2O3 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | heptyl 3-(2-fluoro-4-heptylphenyl)-4-(2-fluorophenyl)benzenecarboperoxoate |
| SMILES | CCCCCCCOOC(=O)c1ccc(-c2ccccc2F)c(-c2ccc(CCCCCCC)cc2F)c1 |
| InChI | InChI=1S/C33H40F2O3/c1-3-5-7-9-11-15-25-18-20-29(32(35)23-25)30-24-26(33(36)38-37-22-14-10-8-6-4-2)19-21-27(30)28-16-12-13-17-31(28)34/h12-13,16-21,23-24H,3-11,14-15,22H2,1-2H3 |
| InChIKey | BTQVXWBPWTUADN-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|