C35H43F3O3 — CID 19793047
octyl 4-(2,3-difluorophenyl)-3-(2-fluoro-4-octylphenyl)benzenecarboperoxoate (PubChem CID 19793047) has the molecular formula C35H43F3O3 and a molecular weight of 568.72 g/mol. Its IUPAC name is octyl 4-(2,3-difluorophenyl)-3-(2-fluoro-4-octylphenyl)benzenecarboperoxoate.
| Compound Name | octyl 4-(2,3-difluorophenyl)-3-(2-fluoro-4-octylphenyl)benzenecarboperoxoate |
|---|---|
| PubChem CID | 19793047 |
| Molecular Formula | C35H43F3O3 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.32 |
| IUPAC Name | octyl 4-(2,3-difluorophenyl)-3-(2-fluoro-4-octylphenyl)benzenecarboperoxoate |
| SMILES | CCCCCCCCOOC(=O)c1ccc(-c2cccc(F)c2F)c(-c2ccc(CCCCCCCC)cc2F)c1 |
| InChI | InChI=1S/C35H43F3O3/c1-3-5-7-9-11-13-16-26-19-21-29(33(37)24-26)31-25-27(35(39)41-40-23-14-12-10-8-6-4-2)20-22-28(31)30-17-15-18-32(36)34(30)38/h15,17-22,24-25H,3-14,16,23H2,1-2H3 |
| InChIKey | PHWANTCBWBELMB-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|