C23H29ClFNO3 — CID 19793176
3-[(3-fluorophenyl)methyl]-6,7,9-trimethoxy-2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole;hydrochloride (PubChem CID 19793176) has the molecular formula C23H29ClFNO3 and a molecular weight of 421.94 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)methyl]-6,7,9-trimethoxy-2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole;hydrochloride.
| Compound Name | 3-[(3-fluorophenyl)methyl]-6,7,9-trimethoxy-2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole;hydrochloride |
|---|---|
| PubChem CID | 19793176 |
| Molecular Formula | C23H29ClFNO3 |
| Molecular Weight | 421.94 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 3-[(3-fluorophenyl)methyl]-6,7,9-trimethoxy-2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole;hydrochloride |
| SMILES | COc1cc(OC)c2c(c1OC)CCC1C2CN(C)C1Cc1cccc(F)c1.Cl |
| InChI | InChI=1S/C23H28FNO3.ClH/c1-25-13-18-16(19(25)11-14-6-5-7-15(24)10-14)8-9-17-22(18)20(26-2)12-21(27-3)23(17)28-4;/h5-7,10,12,16,18-19H,8-9,11,13H2,1-4H3;1H |
| InChIKey | GIVDWKXTJGBTTC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.94 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |