C23H31NO5S — CID 19793187
6,7-dimethoxy-3-[(3-methylphenyl)methyl]-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindole;methanesulfonic acid (PubChem CID 19793187) has the molecular formula C23H31NO5S and a molecular weight of 433.57 g/mol. Its IUPAC name is 6,7-dimethoxy-3-[(3-methylphenyl)methyl]-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindole;methanesulfonic acid.
| Compound Name | 6,7-dimethoxy-3-[(3-methylphenyl)methyl]-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindole;methanesulfonic acid |
|---|---|
| PubChem CID | 19793187 |
| Molecular Formula | C23H31NO5S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 6,7-dimethoxy-3-[(3-methylphenyl)methyl]-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindole;methanesulfonic acid |
| SMILES | COc1ccc2c(c1OC)CCC1C(Cc3cccc(C)c3)NCC21.CS(=O)(=O)O |
| InChI | InChI=1S/C22H27NO2.CH4O3S/c1-14-5-4-6-15(11-14)12-20-17-7-8-18-16(19(17)13-23-20)9-10-21(24-2)22(18)25-3;1-5(2,3)4/h4-6,9-11,17,19-20,23H,7-8,12-13H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | DWNTUMDMCKJVBR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|