C21H26BrNO3S — CID 19793197
3-benzyl-7-bromo-2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole;methanesulfonic acid (PubChem CID 19793197) has the molecular formula C21H26BrNO3S and a molecular weight of 452.41 g/mol. Its IUPAC name is 3-benzyl-7-bromo-2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole;methanesulfonic acid.
| Compound Name | 3-benzyl-7-bromo-2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole;methanesulfonic acid |
|---|---|
| PubChem CID | 19793197 |
| Molecular Formula | C21H26BrNO3S |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 3-benzyl-7-bromo-2-methyl-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole;methanesulfonic acid |
| SMILES | CN1CC2c3ccc(Br)cc3CCC2C1Cc1ccccc1.CS(=O)(=O)O |
| InChI | InChI=1S/C20H22BrN.CH4O3S/c1-22-13-19-17-10-8-16(21)12-15(17)7-9-18(19)20(22)11-14-5-3-2-4-6-14;1-5(2,3)4/h2-6,8,10,12,18-20H,7,9,11,13H2,1H3;1H3,(H,2,3,4) |
| InChIKey | YPHRSLDCVFWCGG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|