C16H16N2O3S — CID 19793421
2-[1,2,3-benzothiadiazol-7-yl(hydroxy)methylidene]-5-propan-2-ylcyclohexane-1,3-dione (PubChem CID 19793421) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-[1,2,3-benzothiadiazol-7-yl(hydroxy)methylidene]-5-propan-2-ylcyclohexane-1,3-dione.
| Compound Name | 2-[1,2,3-benzothiadiazol-7-yl(hydroxy)methylidene]-5-propan-2-ylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 19793421 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2-[1,2,3-benzothiadiazol-7-yl(hydroxy)methylidene]-5-propan-2-ylcyclohexane-1,3-dione |
| SMILES | CC(C)C1CC(=O)C(=C(O)c2cccc3nnsc23)C(=O)C1 |
| InChI | InChI=1S/C16H16N2O3S/c1-8(2)9-6-12(19)14(13(20)7-9)15(21)10-4-3-5-11-16(10)22-18-17-11/h3-5,8-9,21H,6-7H2,1-2H3/b15-14- |
| InChIKey | MHWRARHSZXCGOW-PFONDFGASA-N |
| XLogP | 3.16 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|