C15H20O7 — CID 19793633
[2-(1,4-dihydroxy-3-oxopentyl)-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate (PubChem CID 19793633) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is [2-(1,4-dihydroxy-3-oxopentyl)-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [2-(1,4-dihydroxy-3-oxopentyl)-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 19793633 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | [2-(1,4-dihydroxy-3-oxopentyl)-6-oxo-2,3-dihydropyran-3-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OC1C=CC(=O)OC1C(O)CC(=O)C(C)O |
| InChI | InChI=1S/C15H20O7/c1-4-8(2)15(20)21-12-5-6-13(19)22-14(12)11(18)7-10(17)9(3)16/h4-6,9,11-12,14,16,18H,7H2,1-3H3/b8-4+ |
| InChIKey | QRHAQGAVPSPPFJ-XBXARRHUSA-N |
| XLogP | 0.05 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|