About 1-methylpyrrolidine-2,5-dione;pyrrole-2,5-dione
1-methylpyrrolidine-2,5-dione;pyrrole-2,5-dione (PubChem CID 19793657) has the molecular formula C9H10N2O4
and a molecular weight of 210.19 g/mol. Its IUPAC name is 1-methylpyrrolidine-2,5-dione;pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-methylpyrrolidine-2,5-dione;pyrrole-2,5-dione |
| PubChem CID | 19793657 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 1-methylpyrrolidine-2,5-dione;pyrrole-2,5-dione |
| SMILES | CN1C(=O)CCC1=O.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C5H7NO2.C4H3NO2/c1-6-4(7)2-3-5(6)8;6-3-1-2-4(7)5-3/h2-3H2,1H3;1-2H,(H,5,6,7) |
| InChIKey | KWRJOQJHZLQELM-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpyrrolidine-2,5-dione;pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrolidine-2,5-dione;pyrrole-2,5-dione?
The IUPAC name of 1-methylpyrrolidine-2,5-dione;pyrrole-2,5-dione (CID 19793657) is 1-methylpyrrolidine-2,5-dione;pyrrole-2,5-dione.
What is the SMILES notation for 1-methylpyrrolidine-2,5-dione;pyrrole-2,5-dione?
The canonical SMILES for 1-methylpyrrolidine-2,5-dione;pyrrole-2,5-dione is CN1C(=O)CCC1=O.O=C1C=CC(=O)N1.
What is the InChIKey of 1-methylpyrrolidine-2,5-dione;pyrrole-2,5-dione?
The InChIKey is KWRJOQJHZLQELM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2.C4H3NO2/c1-6-4(7)2-3-5(6)8;6-3-1-2-4(7)5-3/h2-3H2,1H3;1-2H,(H,5,6,7).
What are the key properties of 1-methylpyrrolidine-2,5-dione;pyrrole-2,5-dione?
1-methylpyrrolidine-2,5-dione;pyrrole-2,5-dione has a molecular weight of 210.19 g/mol, XLogP of -1.04, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrolidine-2,5-dione;pyrrole-2,5-dione is sourced from PubChem (CID 19793657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).