About (2,4-dimethyl-1,3-thiazol-5-yl) acetate
(2,4-dimethyl-1,3-thiazol-5-yl) acetate (PubChem CID 19794043) has the molecular formula C7H9NO2S
and a molecular weight of 171.22 g/mol. Its IUPAC name is (2,4-dimethyl-1,3-thiazol-5-yl) acetate.
Molecular Properties
| Compound Name | (2,4-dimethyl-1,3-thiazol-5-yl) acetate |
| PubChem CID | 19794043 |
| Molecular Formula | C7H9NO2S |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | (2,4-dimethyl-1,3-thiazol-5-yl) acetate |
| SMILES | CC(=O)Oc1sc(C)nc1C |
| InChI | InChI=1S/C7H9NO2S/c1-4-7(10-6(3)9)11-5(2)8-4/h1-3H3 |
| InChIKey | PWKAHGVFGASSCK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2,4-dimethyl-1,3-thiazol-5-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dimethyl-1,3-thiazol-5-yl) acetate?
The IUPAC name of (2,4-dimethyl-1,3-thiazol-5-yl) acetate (CID 19794043) is (2,4-dimethyl-1,3-thiazol-5-yl) acetate.
What is the SMILES notation for (2,4-dimethyl-1,3-thiazol-5-yl) acetate?
The canonical SMILES for (2,4-dimethyl-1,3-thiazol-5-yl) acetate is CC(=O)Oc1sc(C)nc1C.
What is the InChIKey of (2,4-dimethyl-1,3-thiazol-5-yl) acetate?
The InChIKey is PWKAHGVFGASSCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2S/c1-4-7(10-6(3)9)11-5(2)8-4/h1-3H3.
What are the key properties of (2,4-dimethyl-1,3-thiazol-5-yl) acetate?
(2,4-dimethyl-1,3-thiazol-5-yl) acetate has a molecular weight of 171.22 g/mol, XLogP of 1.69, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethyl-1,3-thiazol-5-yl) acetate is sourced from PubChem (CID 19794043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).