About [2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 2-fluorobenzoate
[2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 2-fluorobenzoate (PubChem CID 19794595) has the molecular formula C20H21FN2O2S
and a molecular weight of 372.47 g/mol. Its IUPAC name is [2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 2-fluorobenzoate.
Molecular Properties
| Compound Name | [2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 2-fluorobenzoate |
| PubChem CID | 19794595 |
| Molecular Formula | C20H21FN2O2S |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | [2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 2-fluorobenzoate |
| SMILES | CNC(=S)C1(c2cccnc2)CCCCC1OC(=O)c1ccccc1F |
| InChI | InChI=1S/C20H21FN2O2S/c1-22-19(26)20(14-7-6-12-23-13-14)11-5-4-10-17(20)25-18(24)15-8-2-3-9-16(15)21/h2-3,6-9,12-13,17H,4-5,10-11H2,1H3,(H,22,26) |
| InChIKey | ZOWSDKJKEYJHLB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 2-fluorobenzoate?
The IUPAC name of [2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 2-fluorobenzoate (CID 19794595) is [2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 2-fluorobenzoate.
What is the SMILES notation for [2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 2-fluorobenzoate?
The canonical SMILES for [2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 2-fluorobenzoate is CNC(=S)C1(c2cccnc2)CCCCC1OC(=O)c1ccccc1F.
What is the InChIKey of [2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 2-fluorobenzoate?
The InChIKey is ZOWSDKJKEYJHLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21FN2O2S/c1-22-19(26)20(14-7-6-12-23-13-14)11-5-4-10-17(20)25-18(24)15-8-2-3-9-16(15)21/h2-3,6-9,12-13,17H,4-5,10-11H2,1H3,(H,22,26).
What are the key properties of [2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 2-fluorobenzoate?
[2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 2-fluorobenzoate has a molecular weight of 372.47 g/mol, XLogP of 3.80, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(methylcarbamothioyl)-2-pyridin-3-ylcyclohexyl] 2-fluorobenzoate is sourced from PubChem (CID 19794595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).