About 3-hydroxy-2-(4-methylphenyl)sulfinyl-5-(oxan-2-yloxy)docosa-13,14-dienoic acid
3-hydroxy-2-(4-methylphenyl)sulfinyl-5-(oxan-2-yloxy)docosa-13,14-dienoic acid (PubChem CID 19794781) has the molecular formula C34H54O6S
and a molecular weight of 590.87 g/mol. Its IUPAC name is 3-hydroxy-2-(4-methylphenyl)sulfinyl-5-(oxan-2-yloxy)docosa-13,14-dienoic acid.
Molecular Properties
| Compound Name | 3-hydroxy-2-(4-methylphenyl)sulfinyl-5-(oxan-2-yloxy)docosa-13,14-dienoic acid |
| PubChem CID | 19794781 |
| Molecular Formula | C34H54O6S |
| Molecular Weight | 590.87 g/mol |
| Exact Mass | 590.36 |
| IUPAC Name | 3-hydroxy-2-(4-methylphenyl)sulfinyl-5-(oxan-2-yloxy)docosa-13,14-dienoic acid |
| SMILES | CCCCCCCC=C=CCCCCCCCC(CC(O)C(C(=O)O)S(=O)c1ccc(C)cc1)OC1CCCCO1 |
| InChI | InChI=1S/C34H54O6S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-29(40-32-21-18-19-26-39-32)27-31(35)33(34(36)37)41(38)30-24-22-28(2)23-25-30/h9,11,22-25,29,31-33,35H,3-8,12-21,26-27H2,1-2H3,(H,36,37) |
| InChIKey | JQEIKTKMYLWUGT-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 590.87 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-2-(4-methylphenyl)sulfinyl-5-(oxan-2-yloxy)docosa-13,14-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-(4-methylphenyl)sulfinyl-5-(oxan-2-yloxy)docosa-13,14-dienoic acid?
The IUPAC name of 3-hydroxy-2-(4-methylphenyl)sulfinyl-5-(oxan-2-yloxy)docosa-13,14-dienoic acid (CID 19794781) is 3-hydroxy-2-(4-methylphenyl)sulfinyl-5-(oxan-2-yloxy)docosa-13,14-dienoic acid.
What is the SMILES notation for 3-hydroxy-2-(4-methylphenyl)sulfinyl-5-(oxan-2-yloxy)docosa-13,14-dienoic acid?
The canonical SMILES for 3-hydroxy-2-(4-methylphenyl)sulfinyl-5-(oxan-2-yloxy)docosa-13,14-dienoic acid is CCCCCCCC=C=CCCCCCCCC(CC(O)C(C(=O)O)S(=O)c1ccc(C)cc1)OC1CCCCO1.
What is the InChIKey of 3-hydroxy-2-(4-methylphenyl)sulfinyl-5-(oxan-2-yloxy)docosa-13,14-dienoic acid?
The InChIKey is JQEIKTKMYLWUGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H54O6S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-29(40-32-21-18-19-26-39-32)27-31(35)33(34(36)37)41(38)30-24-22-28(2)23-25-30/h9,11,22-25,29,31-33,35H,3-8,12-21,26-27H2,1-2H3,(H,36,37).
What are the key properties of 3-hydroxy-2-(4-methylphenyl)sulfinyl-5-(oxan-2-yloxy)docosa-13,14-dienoic acid?
3-hydroxy-2-(4-methylphenyl)sulfinyl-5-(oxan-2-yloxy)docosa-13,14-dienoic acid has a molecular weight of 590.87 g/mol, XLogP of 8.02, 22 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-(4-methylphenyl)sulfinyl-5-(oxan-2-yloxy)docosa-13,14-dienoic acid is sourced from PubChem (CID 19794781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).