About (E)-2-ethylhex-1-ene-1,3-diol
(E)-2-ethylhex-1-ene-1,3-diol (PubChem CID 19795304) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is (E)-2-ethylhex-1-ene-1,3-diol.
Molecular Properties
| Compound Name | (E)-2-ethylhex-1-ene-1,3-diol |
| PubChem CID | 19795304 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | (E)-2-ethylhex-1-ene-1,3-diol |
| SMILES | CCCC(O)/C(=C/O)CC |
| InChI | InChI=1S/C8H16O2/c1-3-5-8(10)7(4-2)6-9/h6,8-10H,3-5H2,1-2H3/b7-6+ |
| InChIKey | LWOFXGFDOZYYEO-VOTSOKGWSA-N |
| XLogP | 2.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-ethylhex-1-ene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-ethylhex-1-ene-1,3-diol?
The IUPAC name of (E)-2-ethylhex-1-ene-1,3-diol (CID 19795304) is (E)-2-ethylhex-1-ene-1,3-diol.
What is the SMILES notation for (E)-2-ethylhex-1-ene-1,3-diol?
The canonical SMILES for (E)-2-ethylhex-1-ene-1,3-diol is CCCC(O)/C(=C/O)CC.
What is the InChIKey of (E)-2-ethylhex-1-ene-1,3-diol?
The InChIKey is LWOFXGFDOZYYEO-VOTSOKGWSA-N. The full InChI is InChI=1S/C8H16O2/c1-3-5-8(10)7(4-2)6-9/h6,8-10H,3-5H2,1-2H3/b7-6+.
What are the key properties of (E)-2-ethylhex-1-ene-1,3-diol?
(E)-2-ethylhex-1-ene-1,3-diol has a molecular weight of 144.21 g/mol, XLogP of 2.00, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-ethylhex-1-ene-1,3-diol is sourced from PubChem (CID 19795304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).