About pyrimidine-4,5-dicarboxylate
pyrimidine-4,5-dicarboxylate (PubChem CID 19795578) has the molecular formula C6H2N2O4-2
and a molecular weight of 166.09 g/mol. Its IUPAC name is pyrimidine-4,5-dicarboxylate.
Molecular Properties
| Compound Name | pyrimidine-4,5-dicarboxylate |
| PubChem CID | 19795578 |
| Molecular Formula | C6H2N2O4-2 |
| Molecular Weight | 166.09 g/mol |
| Exact Mass | 166.00 |
| IUPAC Name | pyrimidine-4,5-dicarboxylate |
| SMILES | O=C([O-])c1cncnc1C(=O)[O-] |
| InChI | InChI=1S/C6H4N2O4/c9-5(10)3-1-7-2-8-4(3)6(11)12/h1-2H,(H,9,10)(H,11,12)/p-2 |
| InChIKey | HZMKWGOYWYBPRV-UHFFFAOYSA-L |
| XLogP | -2.80 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.09 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze pyrimidine-4,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimidine-4,5-dicarboxylate?
The IUPAC name of pyrimidine-4,5-dicarboxylate (CID 19795578) is pyrimidine-4,5-dicarboxylate.
What is the SMILES notation for pyrimidine-4,5-dicarboxylate?
The canonical SMILES for pyrimidine-4,5-dicarboxylate is O=C([O-])c1cncnc1C(=O)[O-].
What is the InChIKey of pyrimidine-4,5-dicarboxylate?
The InChIKey is HZMKWGOYWYBPRV-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H4N2O4/c9-5(10)3-1-7-2-8-4(3)6(11)12/h1-2H,(H,9,10)(H,11,12)/p-2.
What are the key properties of pyrimidine-4,5-dicarboxylate?
pyrimidine-4,5-dicarboxylate has a molecular weight of 166.09 g/mol, XLogP of -2.80, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimidine-4,5-dicarboxylate is sourced from PubChem (CID 19795578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).