C25H34Cl2N2O3 — CID 19795642
8-[4-(7-chloro-4-methoxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione;hydrochloride (PubChem CID 19795642) has the molecular formula C25H34Cl2N2O3 and a molecular weight of 481.46 g/mol. Its IUPAC name is 8-[4-(7-chloro-4-methoxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione;hydrochloride.
| Compound Name | 8-[4-(7-chloro-4-methoxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione;hydrochloride |
|---|---|
| PubChem CID | 19795642 |
| Molecular Formula | C25H34Cl2N2O3 |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 8-[4-(7-chloro-4-methoxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione;hydrochloride |
| SMILES | COC1c2ccc(Cl)cc2C2CN(CCCCN3C(=O)CC4(CCCC4)CC3=O)CC21.Cl |
| InChI | InChI=1S/C25H33ClN2O3.ClH/c1-31-24-18-7-6-17(26)12-19(18)20-15-27(16-21(20)24)10-4-5-11-28-22(29)13-25(14-23(28)30)8-2-3-9-25;/h6-7,12,20-21,24H,2-5,8-11,13-16H2,1H3;1H |
| InChIKey | YEKOBVGEXRGDIZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|