C25H33ClN2O3 — CID 19795643
8-[4-(7-chloro-4-methoxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 19795643) has the molecular formula C25H33ClN2O3 and a molecular weight of 445.00 g/mol. Its IUPAC name is 8-[4-(7-chloro-4-methoxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione.
| Compound Name | 8-[4-(7-chloro-4-methoxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 19795643 |
| Molecular Formula | C25H33ClN2O3 |
| Molecular Weight | 445.00 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 8-[4-(7-chloro-4-methoxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl)butyl]-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | COC1c2ccc(Cl)cc2C2CN(CCCCN3C(=O)CC4(CCCC4)CC3=O)CC21 |
| InChI | InChI=1S/C25H33ClN2O3/c1-31-24-18-7-6-17(26)12-19(18)20-15-27(16-21(20)24)10-4-5-11-28-22(29)13-25(14-23(28)30)8-2-3-9-25/h6-7,12,20-21,24H,2-5,8-11,13-16H2,1H3 |
| InChIKey | WDWOUJNYWPHLNP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.00 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|