C31H33N3O3 — CID 19795963
4a-(3-methoxyphenyl)-6-methyl-9-nitro-2-(2-phenylethyl)-1,3,4,5,11,11a-hexahydropyrido[4,3-b]carbazole (PubChem CID 19795963) has the molecular formula C31H33N3O3 and a molecular weight of 495.62 g/mol. Its IUPAC name is 4a-(3-methoxyphenyl)-6-methyl-9-nitro-2-(2-phenylethyl)-1,3,4,5,11,11a-hexahydropyrido[4,3-b]carbazole.
| Compound Name | 4a-(3-methoxyphenyl)-6-methyl-9-nitro-2-(2-phenylethyl)-1,3,4,5,11,11a-hexahydropyrido[4,3-b]carbazole |
|---|---|
| PubChem CID | 19795963 |
| Molecular Formula | C31H33N3O3 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 4a-(3-methoxyphenyl)-6-methyl-9-nitro-2-(2-phenylethyl)-1,3,4,5,11,11a-hexahydropyrido[4,3-b]carbazole |
| SMILES | COc1cccc(C23CCN(CCc4ccccc4)CC2Cc2c(n(C)c4ccc([N+](=O)[O-])cc24)C3)c1 |
| InChI | InChI=1S/C31H33N3O3/c1-32-29-12-11-25(34(35)36)19-28(29)27-18-24-21-33(15-13-22-7-4-3-5-8-22)16-14-31(24,20-30(27)32)23-9-6-10-26(17-23)37-2/h3-12,17,19,24H,13-16,18,20-21H2,1-2H3 |
| InChIKey | RWGJKUJBPGJCPM-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 60.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|