C11H9ClN2O — CID 197964
1H-Pyrido(3,4-b)indol-1-one, 2,3,4,9-tetrahydro-6-chloro- (PubChem CID 197964) has the molecular formula C11H9ClN2O and a molecular weight of 220.65 g/mol. Its IUPAC name is 6-chloro-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one.
| Compound Name | 1H-Pyrido(3,4-b)indol-1-one, 2,3,4,9-tetrahydro-6-chloro- |
|---|---|
| PubChem CID | 197964 |
| Molecular Formula | C11H9ClN2O |
| Molecular Weight | 220.65 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 6-chloro-2,3,4,9-tetrahydropyrido[3,4-b]indol-1-one |
| SMILES | C1CNC(=O)C2=C1C3=C(N2)C=CC(=C3)Cl |
| InChI | InChI=1S/C11H9ClN2O/c12-6-1-2-9-8(5-6)7-3-4-13-11(15)10(7)14-9/h1-2,5,14H,3-4H2,(H,13,15) |
| InChIKey | LEAGCIWJKRFYRT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 44.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | 284 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.65 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|