About pentyl 3-butyliminobutanoate
pentyl 3-butyliminobutanoate (PubChem CID 19796778) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is pentyl 3-butyliminobutanoate.
Molecular Properties
| Compound Name | pentyl 3-butyliminobutanoate |
| PubChem CID | 19796778 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | pentyl 3-butyliminobutanoate |
| SMILES | CCCCCOC(=O)C/C(C)=N/CCCC |
| InChI | InChI=1S/C13H25NO2/c1-4-6-8-10-16-13(15)11-12(3)14-9-7-5-2/h4-11H2,1-3H3/b14-12+ |
| InChIKey | XXWPQNMEPZJGPY-WYMLVPIESA-N |
| XLogP | 3.37 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze pentyl 3-butyliminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl 3-butyliminobutanoate?
The IUPAC name of pentyl 3-butyliminobutanoate (CID 19796778) is pentyl 3-butyliminobutanoate.
What is the SMILES notation for pentyl 3-butyliminobutanoate?
The canonical SMILES for pentyl 3-butyliminobutanoate is CCCCCOC(=O)C/C(C)=N/CCCC.
What is the InChIKey of pentyl 3-butyliminobutanoate?
The InChIKey is XXWPQNMEPZJGPY-WYMLVPIESA-N. The full InChI is InChI=1S/C13H25NO2/c1-4-6-8-10-16-13(15)11-12(3)14-9-7-5-2/h4-11H2,1-3H3/b14-12+.
What are the key properties of pentyl 3-butyliminobutanoate?
pentyl 3-butyliminobutanoate has a molecular weight of 227.35 g/mol, XLogP of 3.37, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl 3-butyliminobutanoate is sourced from PubChem (CID 19796778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).