About ethyl 3-hexyliminobutanoate
ethyl 3-hexyliminobutanoate (PubChem CID 19796802) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is ethyl 3-hexyliminobutanoate.
Molecular Properties
| Compound Name | ethyl 3-hexyliminobutanoate |
| PubChem CID | 19796802 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | ethyl 3-hexyliminobutanoate |
| SMILES | CCCCCC/N=C(\C)CC(=O)OCC |
| InChI | InChI=1S/C12H23NO2/c1-4-6-7-8-9-13-11(3)10-12(14)15-5-2/h4-10H2,1-3H3/b13-11+ |
| InChIKey | MLABFYTZSDFMGV-ACCUITESSA-N |
| XLogP | 2.98 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-hexyliminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-hexyliminobutanoate?
The IUPAC name of ethyl 3-hexyliminobutanoate (CID 19796802) is ethyl 3-hexyliminobutanoate.
What is the SMILES notation for ethyl 3-hexyliminobutanoate?
The canonical SMILES for ethyl 3-hexyliminobutanoate is CCCCCC/N=C(\C)CC(=O)OCC.
What is the InChIKey of ethyl 3-hexyliminobutanoate?
The InChIKey is MLABFYTZSDFMGV-ACCUITESSA-N. The full InChI is InChI=1S/C12H23NO2/c1-4-6-7-8-9-13-11(3)10-12(14)15-5-2/h4-10H2,1-3H3/b13-11+.
What are the key properties of ethyl 3-hexyliminobutanoate?
ethyl 3-hexyliminobutanoate has a molecular weight of 213.32 g/mol, XLogP of 2.98, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-hexyliminobutanoate is sourced from PubChem (CID 19796802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).