C19H28N4O6 — CID 19797375
N-[5-(1-azabicyclo[2.2.2]octan-3-yl)-1,2,4-oxadiazol-3-yl]-3-cyclopentylpropanamide;oxalic acid (PubChem CID 19797375) has the molecular formula C19H28N4O6 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-[5-(1-azabicyclo[2.2.2]octan-3-yl)-1,2,4-oxadiazol-3-yl]-3-cyclopentylpropanamide;oxalic acid.
| Compound Name | N-[5-(1-azabicyclo[2.2.2]octan-3-yl)-1,2,4-oxadiazol-3-yl]-3-cyclopentylpropanamide;oxalic acid |
|---|---|
| PubChem CID | 19797375 |
| Molecular Formula | C19H28N4O6 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-[5-(1-azabicyclo[2.2.2]octan-3-yl)-1,2,4-oxadiazol-3-yl]-3-cyclopentylpropanamide;oxalic acid |
| SMILES | O=C(CCC1CCCC1)Nc1noc(C2CN3CCC2CC3)n1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H26N4O2.C2H2O4/c22-15(6-5-12-3-1-2-4-12)18-17-19-16(23-20-17)14-11-21-9-7-13(14)8-10-21;3-1(4)2(5)6/h12-14H,1-11H2,(H,18,20,22);(H,3,4)(H,5,6) |
| InChIKey | ADPKNGSDYIQBDC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|