C14H21NO4 — CID 19797507
2-tert-butyl-7-oxabicyclo[2.2.1]hepta-1,3,5-triene;1-hydroxypropyl carbamate (PubChem CID 19797507) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 2-tert-butyl-7-oxabicyclo[2.2.1]hepta-1,3,5-triene;1-hydroxypropyl carbamate.
| Compound Name | 2-tert-butyl-7-oxabicyclo[2.2.1]hepta-1,3,5-triene;1-hydroxypropyl carbamate |
|---|---|
| PubChem CID | 19797507 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 2-tert-butyl-7-oxabicyclo[2.2.1]hepta-1,3,5-triene;1-hydroxypropyl carbamate |
| SMILES | CC(C)(C)c1cc2ccc1o2.CCC(O)OC(N)=O |
| InChI | InChI=1S/C10H12O.C4H9NO3/c1-10(2,3)8-6-7-4-5-9(8)11-7;1-2-3(6)8-4(5)7/h4-6H,1-3H3;3,6H,2H2,1H3,(H2,5,7) |
| InChIKey | SFHJJNGMXQULBQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|