About 2-(2-hydroxy-4,6-diphenylphenyl)-3,5-diphenylphenol
2-(2-hydroxy-4,6-diphenylphenyl)-3,5-diphenylphenol (PubChem CID 19797768) has the molecular formula C36H26O2
and a molecular weight of 490.60 g/mol. Its IUPAC name is 2-(2-hydroxy-4,6-diphenylphenyl)-3,5-diphenylphenol.
Molecular Properties
| Compound Name | 2-(2-hydroxy-4,6-diphenylphenyl)-3,5-diphenylphenol |
| PubChem CID | 19797768 |
| Molecular Formula | C36H26O2 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 2-(2-hydroxy-4,6-diphenylphenyl)-3,5-diphenylphenol |
| SMILES | Oc1cc(-c2ccccc2)cc(-c2ccccc2)c1-c1c(O)cc(-c2ccccc2)cc1-c1ccccc1 |
| InChI | InChI=1S/C36H26O2/c37-33-23-29(25-13-5-1-6-14-25)21-31(27-17-9-3-10-18-27)35(33)36-32(28-19-11-4-12-20-28)22-30(24-34(36)38)26-15-7-2-8-16-26/h1-24,37-38H |
| InChIKey | PZBWYVLWGGXVAW-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-hydroxy-4,6-diphenylphenyl)-3,5-diphenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxy-4,6-diphenylphenyl)-3,5-diphenylphenol?
The IUPAC name of 2-(2-hydroxy-4,6-diphenylphenyl)-3,5-diphenylphenol (CID 19797768) is 2-(2-hydroxy-4,6-diphenylphenyl)-3,5-diphenylphenol.
What is the SMILES notation for 2-(2-hydroxy-4,6-diphenylphenyl)-3,5-diphenylphenol?
The canonical SMILES for 2-(2-hydroxy-4,6-diphenylphenyl)-3,5-diphenylphenol is Oc1cc(-c2ccccc2)cc(-c2ccccc2)c1-c1c(O)cc(-c2ccccc2)cc1-c1ccccc1.
What is the InChIKey of 2-(2-hydroxy-4,6-diphenylphenyl)-3,5-diphenylphenol?
The InChIKey is PZBWYVLWGGXVAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H26O2/c37-33-23-29(25-13-5-1-6-14-25)21-31(27-17-9-3-10-18-27)35(33)36-32(28-19-11-4-12-20-28)22-30(24-34(36)38)26-15-7-2-8-16-26/h1-24,37-38H.
What are the key properties of 2-(2-hydroxy-4,6-diphenylphenyl)-3,5-diphenylphenol?
2-(2-hydroxy-4,6-diphenylphenyl)-3,5-diphenylphenol has a molecular weight of 490.60 g/mol, XLogP of 9.43, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxy-4,6-diphenylphenyl)-3,5-diphenylphenol is sourced from PubChem (CID 19797768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).