C54H36N2O6 — CID 19797770
2-methyl-5-[4-[4-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-3,5-diphenylphenyl]-2,6-diphenylphenoxy]isoindole-1,3-dione (PubChem CID 19797770) has the molecular formula C54H36N2O6 and a molecular weight of 808.89 g/mol. Its IUPAC name is 2-methyl-5-[4-[4-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-3,5-diphenylphenyl]-2,6-diphenylphenoxy]isoindole-1,3-dione.
| Compound Name | 2-methyl-5-[4-[4-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-3,5-diphenylphenyl]-2,6-diphenylphenoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 19797770 |
| Molecular Formula | C54H36N2O6 |
| Molecular Weight | 808.89 g/mol |
| Exact Mass | 808.26 |
| IUPAC Name | 2-methyl-5-[4-[4-(2-methyl-1,3-dioxoisoindol-5-yl)oxy-3,5-diphenylphenyl]-2,6-diphenylphenoxy]isoindole-1,3-dione |
| SMILES | CN1C(=O)c2ccc(Oc3c(-c4ccccc4)cc(-c4cc(-c5ccccc5)c(Oc5ccc6c(c5)C(=O)N(C)C6=O)c(-c5ccccc5)c4)cc3-c3ccccc3)cc2C1=O |
| InChI | InChI=1S/C54H36N2O6/c1-55-51(57)41-25-23-39(31-47(41)53(55)59)61-49-43(33-15-7-3-8-16-33)27-37(28-44(49)34-17-9-4-10-18-34)38-29-45(35-19-11-5-12-20-35)50(46(30-38)36-21-13-6-14-22-36)62-40-24-26-42-48(32-40)54(60)56(2)52(42)58/h3-32H,1-2H3 |
| InChIKey | DVZMTYVLSYTUJT-UHFFFAOYSA-N |
| XLogP | 12.06 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.89 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|