About azane;tricyclo[4.4.0.03,8]deca-1(6),2,4,7,9-pentaene
azane;tricyclo[4.4.0.03,8]deca-1(6),2,4,7,9-pentaene (PubChem CID 19797800) has the molecular formula C10H9N
and a molecular weight of 143.19 g/mol. Its IUPAC name is azane;tricyclo[4.4.0.03,8]deca-1(6),2,4,7,9-pentaene.
Analyze azane;tricyclo[4.4.0.03,8]deca-1(6),2,4,7,9-pentaene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;tricyclo[4.4.0.03,8]deca-1(6),2,4,7,9-pentaene?
The IUPAC name of azane;tricyclo[4.4.0.03,8]deca-1(6),2,4,7,9-pentaene (CID 19797800) is azane;tricyclo[4.4.0.03,8]deca-1(6),2,4,7,9-pentaene.
What is the SMILES notation for azane;tricyclo[4.4.0.03,8]deca-1(6),2,4,7,9-pentaene?
The canonical SMILES for azane;tricyclo[4.4.0.03,8]deca-1(6),2,4,7,9-pentaene is N.c1cc2cc3ccc2cc13.
What is the InChIKey of azane;tricyclo[4.4.0.03,8]deca-1(6),2,4,7,9-pentaene?
The InChIKey is UJDAMKQKCGPOMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6.H3N/c1-2-8-6-9-3-4-10(8)5-7(1)9;/h1-6H;1H3.
What are the key properties of azane;tricyclo[4.4.0.03,8]deca-1(6),2,4,7,9-pentaene?
azane;tricyclo[4.4.0.03,8]deca-1(6),2,4,7,9-pentaene has a molecular weight of 143.19 g/mol, XLogP of 3.03, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;tricyclo[4.4.0.03,8]deca-1(6),2,4,7,9-pentaene is sourced from PubChem (CID 19797800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).