About [2-(tritylamino)-1,3-thiazol-4-yl] 2-(ethylaminooxymethyl)benzoate
[2-(tritylamino)-1,3-thiazol-4-yl] 2-(ethylaminooxymethyl)benzoate (PubChem CID 19797826) has the molecular formula C32H29N3O3S
and a molecular weight of 535.67 g/mol. Its IUPAC name is [2-(tritylamino)-1,3-thiazol-4-yl] 2-(ethylaminooxymethyl)benzoate.
Molecular Properties
| Compound Name | [2-(tritylamino)-1,3-thiazol-4-yl] 2-(ethylaminooxymethyl)benzoate |
| PubChem CID | 19797826 |
| Molecular Formula | C32H29N3O3S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | [2-(tritylamino)-1,3-thiazol-4-yl] 2-(ethylaminooxymethyl)benzoate |
| SMILES | CCNOCc1ccccc1C(=O)Oc1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C32H29N3O3S/c1-2-33-37-22-24-14-12-13-21-28(24)30(36)38-29-23-39-31(34-29)35-32(25-15-6-3-7-16-25,26-17-8-4-9-18-26)27-19-10-5-11-20-27/h3-21,23,33H,2,22H2,1H3,(H,34,35) |
| InChIKey | OYYQHEGGHOJVFI-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze [2-(tritylamino)-1,3-thiazol-4-yl] 2-(ethylaminooxymethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(tritylamino)-1,3-thiazol-4-yl] 2-(ethylaminooxymethyl)benzoate?
The IUPAC name of [2-(tritylamino)-1,3-thiazol-4-yl] 2-(ethylaminooxymethyl)benzoate (CID 19797826) is [2-(tritylamino)-1,3-thiazol-4-yl] 2-(ethylaminooxymethyl)benzoate.
What is the SMILES notation for [2-(tritylamino)-1,3-thiazol-4-yl] 2-(ethylaminooxymethyl)benzoate?
The canonical SMILES for [2-(tritylamino)-1,3-thiazol-4-yl] 2-(ethylaminooxymethyl)benzoate is CCNOCc1ccccc1C(=O)Oc1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1.
What is the InChIKey of [2-(tritylamino)-1,3-thiazol-4-yl] 2-(ethylaminooxymethyl)benzoate?
The InChIKey is OYYQHEGGHOJVFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H29N3O3S/c1-2-33-37-22-24-14-12-13-21-28(24)30(36)38-29-23-39-31(34-29)35-32(25-15-6-3-7-16-25,26-17-8-4-9-18-26)27-19-10-5-11-20-27/h3-21,23,33H,2,22H2,1H3,(H,34,35).
What are the key properties of [2-(tritylamino)-1,3-thiazol-4-yl] 2-(ethylaminooxymethyl)benzoate?
[2-(tritylamino)-1,3-thiazol-4-yl] 2-(ethylaminooxymethyl)benzoate has a molecular weight of 535.67 g/mol, XLogP of 6.81, 11 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(tritylamino)-1,3-thiazol-4-yl] 2-(ethylaminooxymethyl)benzoate is sourced from PubChem (CID 19797826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).