About dichlorotetrasilane
dichlorotetrasilane (PubChem CID 19797887) has the molecular formula Cl2Si4
and a molecular weight of 183.25 g/mol.
Molecular Properties
| Compound Name | dichlorotetrasilane |
|---|
| PubChem CID | 19797887 |
|---|
| Molecular Formula | Cl2Si4 |
|---|
| Molecular Weight | 183.25 g/mol |
|---|
| Exact Mass | 181.85 |
|---|
| IUPAC Name | — |
|---|
| SMILES | [Si][Si][Si][Si](Cl)Cl |
|---|
| InChI | InChI=1S/Cl2Si4/c1-6(2)5-4-3 |
|---|
| InChIKey | SWTSHTYMGMNGPA-UHFFFAOYSA-N |
|---|
| XLogP | -0.14 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | 2 |
|---|
| Heavy Atoms | 6 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze dichlorotetrasilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorotetrasilane?
The IUPAC name of dichlorotetrasilane (CID 19797887) is not available.
What is the SMILES notation for dichlorotetrasilane?
The canonical SMILES for dichlorotetrasilane is [Si][Si][Si][Si](Cl)Cl.
What is the InChIKey of dichlorotetrasilane?
The InChIKey is SWTSHTYMGMNGPA-UHFFFAOYSA-N. The full InChI is InChI=1S/Cl2Si4/c1-6(2)5-4-3.
What are the key properties of dichlorotetrasilane?
dichlorotetrasilane has a molecular weight of 183.25 g/mol, XLogP of -0.14, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorotetrasilane is sourced from PubChem (CID 19797887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).