About 3-methylbut-1-ene;urea
3-methylbut-1-ene;urea (PubChem CID 19798125) has the molecular formula C6H14N2O
and a molecular weight of 130.19 g/mol. Its IUPAC name is 3-methylbut-1-ene;urea.
Molecular Properties
| Compound Name | 3-methylbut-1-ene;urea |
| PubChem CID | 19798125 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | 3-methylbut-1-ene;urea |
| SMILES | C=CC(C)C.NC(N)=O |
| InChI | InChI=1S/C5H10.CH4N2O/c1-4-5(2)3;2-1(3)4/h4-5H,1H2,2-3H3;(H4,2,3,4) |
| InChIKey | MGVOQGLGGIGSTC-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-1-ene;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-1-ene;urea?
The IUPAC name of 3-methylbut-1-ene;urea (CID 19798125) is 3-methylbut-1-ene;urea.
What is the SMILES notation for 3-methylbut-1-ene;urea?
The canonical SMILES for 3-methylbut-1-ene;urea is C=CC(C)C.NC(N)=O.
What is the InChIKey of 3-methylbut-1-ene;urea?
The InChIKey is MGVOQGLGGIGSTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10.CH4N2O/c1-4-5(2)3;2-1(3)4/h4-5H,1H2,2-3H3;(H4,2,3,4).
What are the key properties of 3-methylbut-1-ene;urea?
3-methylbut-1-ene;urea has a molecular weight of 130.19 g/mol, XLogP of 0.85, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-1-ene;urea is sourced from PubChem (CID 19798125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).