About 1,3,5-triisocyanatopentane
1,3,5-triisocyanatopentane (PubChem CID 19798161) has the molecular formula C8H9N3O3
and a molecular weight of 195.18 g/mol. Its IUPAC name is 1,3,5-triisocyanatopentane.
Molecular Properties
| Compound Name | 1,3,5-triisocyanatopentane |
| PubChem CID | 19798161 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 1,3,5-triisocyanatopentane |
| SMILES | O=C=NCCC(CCN=C=O)N=C=O |
| InChI | InChI=1S/C8H9N3O3/c12-5-9-3-1-8(11-7-14)2-4-10-6-13/h8H,1-4H2 |
| InChIKey | RSSXARGLGJGRJO-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 88.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1,3,5-triisocyanatopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-triisocyanatopentane?
The IUPAC name of 1,3,5-triisocyanatopentane (CID 19798161) is 1,3,5-triisocyanatopentane.
What is the SMILES notation for 1,3,5-triisocyanatopentane?
The canonical SMILES for 1,3,5-triisocyanatopentane is O=C=NCCC(CCN=C=O)N=C=O.
What is the InChIKey of 1,3,5-triisocyanatopentane?
The InChIKey is RSSXARGLGJGRJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O3/c12-5-9-3-1-8(11-7-14)2-4-10-6-13/h8H,1-4H2.
What are the key properties of 1,3,5-triisocyanatopentane?
1,3,5-triisocyanatopentane has a molecular weight of 195.18 g/mol, XLogP of 0.14, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-triisocyanatopentane is sourced from PubChem (CID 19798161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).